C27H25NO4S — CID 162675469
(3aS,9bS)-6-methyl-3-methylidene-1-(4-methylphenyl)sulfonyl-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione (PubChem CID 162675469) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is (3aS,9bS)-6-methyl-3-methylidene-1-(4-methylphenyl)sulfonyl-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione.
| Compound Name | (3aS,9bS)-6-methyl-3-methylidene-1-(4-methylphenyl)sulfonyl-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione |
|---|---|
| PubChem CID | 162675469 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (3aS,9bS)-6-methyl-3-methylidene-1-(4-methylphenyl)sulfonyl-9-phenyl-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione |
| SMILES | C=C1C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]2C3=C(c4ccccc4)C(=O)CC3=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C27H25NO4S/c1-16-9-12-20(13-10-16)33(31,32)28-26-21(18(3)27(28)30)14-11-17(2)22-15-23(29)24(25(22)26)19-7-5-4-6-8-19/h4-10,12-13,21,26H,3,11,14-15H2,1-2H3/t21-,26-/m0/s1 |
| InChIKey | TXYJPRPGQADIAC-LVXARBLLSA-N |
| XLogP | 4.60 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|