C15H26O2 — CID 162675620
2-[(1R,2E,4S,7Z)-8-(hydroxymethyl)-4-methylcyclodeca-2,7-dien-1-yl]propan-2-ol (PubChem CID 162675620) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(1R,2E,4S,7Z)-8-(hydroxymethyl)-4-methylcyclodeca-2,7-dien-1-yl]propan-2-ol.
| Compound Name | 2-[(1R,2E,4S,7Z)-8-(hydroxymethyl)-4-methylcyclodeca-2,7-dien-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 162675620 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(1R,2E,4S,7Z)-8-(hydroxymethyl)-4-methylcyclodeca-2,7-dien-1-yl]propan-2-ol |
| SMILES | C[C@@H]1/C=C/[C@H](C(C)(C)O)CC/C(CO)=C/CC1 |
| InChI | InChI=1S/C15H26O2/c1-12-5-4-6-13(11-16)8-10-14(9-7-12)15(2,3)17/h6-7,9,12,14,16-17H,4-5,8,10-11H2,1-3H3/b9-7+,13-6-/t12-,14-/m0/s1 |
| InChIKey | BDULPBCKEVQRLE-POXPZTADSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|