C22H27N5O3 — CID 162675660
(1S)-1-[1-[[5-[2-[4-[3-(2-aminoethylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol (PubChem CID 162675660) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (1S)-1-[1-[[5-[2-[4-[3-(2-aminoethylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol.
| Compound Name | (1S)-1-[1-[[5-[2-[4-[3-(2-aminoethylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 162675660 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (1S)-1-[1-[[5-[2-[4-[3-(2-aminoethylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
| SMILES | C[C@H](O)c1nccn1Cc1cc(C#Cc2ccc(OCCCNCCN)cc2)on1 |
| InChI | InChI=1S/C22H27N5O3/c1-17(28)22-25-12-13-27(22)16-19-15-21(30-26-19)8-5-18-3-6-20(7-4-18)29-14-2-10-24-11-9-23/h3-4,6-7,12-13,15,17,24,28H,2,9-11,14,16,23H2,1H3/t17-/m0/s1 |
| InChIKey | UNTMFNDWEVZFQX-KRWDZBQOSA-N |
| XLogP | 1.69 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|