C24H45NO — CID 162675818
(9Z,12Z)-N-(3,3-dimethylbutan-2-yl)octadeca-9,12-dienamide (PubChem CID 162675818) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is (9Z,12Z)-N-(3,3-dimethylbutan-2-yl)octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-(3,3-dimethylbutan-2-yl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 162675818 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | (9Z,12Z)-N-(3,3-dimethylbutan-2-yl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C24H45NO/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(26)25-22(2)24(3,4)5/h10-11,13-14,22H,6-9,12,15-21H2,1-5H3,(H,25,26)/b11-10-,14-13- |
| InChIKey | SZIKLZQOULICIS-XVTLYKPTSA-N |
| XLogP | 7.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|