C36H39N3O6 — CID 162675885
methyl 3-[[3,5-bis[(3-methoxycarbonylanilino)methyl]-2,4,6-trimethylphenyl]methylamino]benzoate (PubChem CID 162675885) has the molecular formula C36H39N3O6 and a molecular weight of 609.72 g/mol. Its IUPAC name is methyl 3-[[3,5-bis[(3-methoxycarbonylanilino)methyl]-2,4,6-trimethylphenyl]methylamino]benzoate.
| Compound Name | methyl 3-[[3,5-bis[(3-methoxycarbonylanilino)methyl]-2,4,6-trimethylphenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 162675885 |
| Molecular Formula | C36H39N3O6 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | methyl 3-[[3,5-bis[(3-methoxycarbonylanilino)methyl]-2,4,6-trimethylphenyl]methylamino]benzoate |
| SMILES | COC(=O)c1cccc(NCc2c(C)c(CNc3cccc(C(=O)OC)c3)c(C)c(CNc3cccc(C(=O)OC)c3)c2C)c1 |
| InChI | InChI=1S/C36H39N3O6/c1-22-31(19-37-28-13-7-10-25(16-28)34(40)43-4)23(2)33(21-39-30-15-9-12-27(18-30)36(42)45-6)24(3)32(22)20-38-29-14-8-11-26(17-29)35(41)44-5/h7-18,37-39H,19-21H2,1-6H3 |
| InChIKey | ZAEVPPJFFUYPRP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|