C20H22O4 — CID 162676368
(9S,12R,16S)-3-hydroxy-12,16-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,5,7-tetraene-4,11-dione (PubChem CID 162676368) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (9S,12R,16S)-3-hydroxy-12,16-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,5,7-tetraene-4,11-dione.
| Compound Name | (9S,12R,16S)-3-hydroxy-12,16-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,5,7-tetraene-4,11-dione |
|---|---|
| PubChem CID | 162676368 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (9S,12R,16S)-3-hydroxy-12,16-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,5,7-tetraene-4,11-dione |
| SMILES | CC(C)C1=CC2=C[C@@H]3OC(=O)[C@]4(C)CCC=C(C2=C(O)C1=O)[C@]34C |
| InChI | InChI=1S/C20H22O4/c1-10(2)12-8-11-9-14-20(4)13(15(11)17(22)16(12)21)6-5-7-19(20,3)18(23)24-14/h6,8-10,14,22H,5,7H2,1-4H3/t14-,19-,20+/m0/s1 |
| InChIKey | QWOGTLBFOVFJQK-PNHOKKKMSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |