C29H33N9O6 — CID 162676711
4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 162676711) has the molecular formula C29H33N9O6 and a molecular weight of 603.64 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 162676711 |
| Molecular Formula | C29H33N9O6 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)OCCCCNC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C29H33N9O6/c1-29(2,3)44-28(41)30-13-5-6-14-43-22(39)16-18-9-11-19(12-10-18)31-27(40)34-26-33-23-20(17-37(4)35-23)25-32-24(36-38(25)26)21-8-7-15-42-21/h7-12,15,17H,5-6,13-14,16H2,1-4H3,(H,30,41)(H2,31,33,34,35,40) |
| InChIKey | HLGJNEFOSUCSDA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|