C18H18Cl3N5O2 — CID 162676716
2-phenyl-1-[3-(2,4,5-trichlorophenoxy)propoxy]-2H-1,3,5-triazine-4,6-diamine (PubChem CID 162676716) has the molecular formula C18H18Cl3N5O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 2-phenyl-1-[3-(2,4,5-trichlorophenoxy)propoxy]-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 2-phenyl-1-[3-(2,4,5-trichlorophenoxy)propoxy]-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 162676716 |
| Molecular Formula | C18H18Cl3N5O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-phenyl-1-[3-(2,4,5-trichlorophenoxy)propoxy]-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NC(c2ccccc2)N(OCCCOc2cc(Cl)c(Cl)cc2Cl)C(N)=N1 |
| InChI | InChI=1S/C18H18Cl3N5O2/c19-12-9-14(21)15(10-13(12)20)27-7-4-8-28-26-16(11-5-2-1-3-6-11)24-17(22)25-18(26)23/h1-3,5-6,9-10,16H,4,7-8H2,(H4,22,23,24,25) |
| InChIKey | YNUGIDOLOHSWTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|