C27H37N3O5S — CID 162676719
(2S,3S)-2-[[(2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-N-hydroxy-3-methylpentanamide (PubChem CID 162676719) has the molecular formula C27H37N3O5S and a molecular weight of 515.68 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-N-hydroxy-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-N-hydroxy-3-methylpentanamide |
|---|---|
| PubChem CID | 162676719 |
| Molecular Formula | C27H37N3O5S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-N-hydroxy-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C2CCCCC2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H37N3O5S/c1-3-19(2)25(27(32)29-33)28-26(31)24(18-20-10-6-4-7-11-20)30-36(34,35)23-16-14-22(15-17-23)21-12-8-5-9-13-21/h4,6-7,10-11,14-17,19,21,24-25,30,33H,3,5,8-9,12-13,18H2,1-2H3,(H,28,31)(H,29,32)/t19-,24-,25-/m0/s1 |
| InChIKey | XMZGZGJPEGLQMX-LQGLAIQGSA-N |
| XLogP | 3.66 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|