C20H16O6 — CID 162676818
(3R)-3-ethyl-3,6,8-trihydroxy-2,4-dihydrobenzo[a]anthracene-1,7,12-trione (PubChem CID 162676818) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is (3R)-3-ethyl-3,6,8-trihydroxy-2,4-dihydrobenzo[a]anthracene-1,7,12-trione.
| Compound Name | (3R)-3-ethyl-3,6,8-trihydroxy-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
|---|---|
| PubChem CID | 162676818 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3R)-3-ethyl-3,6,8-trihydroxy-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
| SMILES | CC[C@]1(O)CC(=O)c2c(cc(O)c3c2C(=O)c2cccc(O)c2C3=O)C1 |
| InChI | InChI=1S/C20H16O6/c1-2-20(26)7-9-6-12(22)16-17(14(9)13(23)8-20)18(24)10-4-3-5-11(21)15(10)19(16)25/h3-6,21-22,26H,2,7-8H2,1H3/t20-/m1/s1 |
| InChIKey | OCYQHXBOHOPBJF-HXUWFJFHSA-N |
| XLogP | 2.14 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|