C20H22O7 — CID 162676948
[(1S,3R,5S,6S,10R,11S)-3-methyl-9-methylidene-8,14-dioxo-4,7,15-trioxatetracyclo[11.2.1.03,5.06,10]hexadec-13(16)-en-11-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162676948) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(1S,3R,5S,6S,10R,11S)-3-methyl-9-methylidene-8,14-dioxo-4,7,15-trioxatetracyclo[11.2.1.03,5.06,10]hexadec-13(16)-en-11-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3R,5S,6S,10R,11S)-3-methyl-9-methylidene-8,14-dioxo-4,7,15-trioxatetracyclo[11.2.1.03,5.06,10]hexadec-13(16)-en-11-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162676948 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(1S,3R,5S,6S,10R,11S)-3-methyl-9-methylidene-8,14-dioxo-4,7,15-trioxatetracyclo[11.2.1.03,5.06,10]hexadec-13(16)-en-11-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)/C(C)=C\C)CC1=C[C@H](C[C@@]3(C)O[C@@H]23)OC1=O |
| InChI | InChI=1S/C20H22O7/c1-5-9(2)17(21)25-13-7-11-6-12(24-19(11)23)8-20(4)16(27-20)15-14(13)10(3)18(22)26-15/h5-6,12-16H,3,7-8H2,1-2,4H3/b9-5-/t12-,13+,14-,15+,16+,20-/m1/s1 |
| InChIKey | QXRZYYIOSHQUKY-CUJLFFNASA-N |
| XLogP | 1.77 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|