C20H19NO2 — CID 162677027
(1S,7S,9R)-7-phenyl-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-3-one (PubChem CID 162677027) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (1S,7S,9R)-7-phenyl-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-3-one.
| Compound Name | (1S,7S,9R)-7-phenyl-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-3-one |
|---|---|
| PubChem CID | 162677027 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (1S,7S,9R)-7-phenyl-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-trien-3-one |
| SMILES | O=C1CCC[C@@]2(c3ccccc3)O[C@@H]3Cc4ccccc4[C@@H]3N12 |
| InChI | InChI=1S/C20H19NO2/c22-18-11-6-12-20(15-8-2-1-3-9-15)21(18)19-16-10-5-4-7-14(16)13-17(19)23-20/h1-5,7-10,17,19H,6,11-13H2/t17-,19+,20+/m1/s1 |
| InChIKey | QLDUBNIVVLEKLI-HOJAQTOUSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |