C21H27N5O3 — CID 162677092
8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(oxan-4-ylmethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 162677092) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(oxan-4-ylmethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(oxan-4-ylmethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 162677092 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(oxan-4-ylmethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COc1ccc(-c2c(C)nn3c(NCC4CCOCC4)nc(C)nc23)cc1OC |
| InChI | InChI=1S/C21H27N5O3/c1-13-19(16-5-6-17(27-3)18(11-16)28-4)20-23-14(2)24-21(26(20)25-13)22-12-15-7-9-29-10-8-15/h5-6,11,15H,7-10,12H2,1-4H3,(H,22,23,24) |
| InChIKey | ZUIBZTJJNDGTIY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |