About N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide
N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide (PubChem CID 162677105) has the molecular formula C22H25FN4O4
and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide |
| PubChem CID | 162677105 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide |
| SMILES | COc1ccc(F)c(-c2ccc3c(NC(=O)CCCCCCC(=O)NO)n[nH]c3c2)c1 |
| InChI | InChI=1S/C22H25FN4O4/c1-31-15-9-11-18(23)17(13-15)14-8-10-16-19(12-14)25-26-22(16)24-20(28)6-4-2-3-5-7-21(29)27-30/h8-13,30H,2-7H2,1H3,(H,27,29)(H2,24,25,26,28) |
| InChIKey | YGSWEHGPONOFLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide?
The IUPAC name of N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide (CID 162677105) is N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide is COc1ccc(F)c(-c2ccc3c(NC(=O)CCCCCCC(=O)NO)n[nH]c3c2)c1.
What is the InChIKey of N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide?
The InChIKey is YGSWEHGPONOFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN4O4/c1-31-15-9-11-18(23)17(13-15)14-8-10-16-19(12-14)25-26-22(16)24-20(28)6-4-2-3-5-7-21(29)27-30/h8-13,30H,2-7H2,1H3,(H,27,29)(H2,24,25,26,28).
What are the key properties of N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide?
N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide has a molecular weight of 428.46 g/mol, XLogP of 4.16, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2-fluoro-5-methoxyphenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide is sourced from PubChem (CID 162677105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).