C24H27NO7 — CID 162677196
2,4-dihydroxy-3-[3-[(1S,2R,4R,6S,7R,9R)-6-methyl-10-methylidene-5-oxo-3-oxatetracyclo[7.2.2.01,7.02,4]tridecan-6-yl]propanoylamino]benzoic acid (PubChem CID 162677196) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 2,4-dihydroxy-3-[3-[(1S,2R,4R,6S,7R,9R)-6-methyl-10-methylidene-5-oxo-3-oxatetracyclo[7.2.2.01,7.02,4]tridecan-6-yl]propanoylamino]benzoic acid.
| Compound Name | 2,4-dihydroxy-3-[3-[(1S,2R,4R,6S,7R,9R)-6-methyl-10-methylidene-5-oxo-3-oxatetracyclo[7.2.2.01,7.02,4]tridecan-6-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 162677196 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2,4-dihydroxy-3-[3-[(1S,2R,4R,6S,7R,9R)-6-methyl-10-methylidene-5-oxo-3-oxatetracyclo[7.2.2.01,7.02,4]tridecan-6-yl]propanoylamino]benzoic acid |
| SMILES | C=C1C[C@@]23CC[C@@H]1C[C@H]2[C@](C)(CCC(=O)Nc1c(O)ccc(C(=O)O)c1O)C(=O)[C@@H]1O[C@@H]13 |
| InChI | InChI=1S/C24H27NO7/c1-11-10-24-8-5-12(11)9-15(24)23(2,20(29)19-21(24)32-19)7-6-16(27)25-17-14(26)4-3-13(18(17)28)22(30)31/h3-4,12,15,19,21,26,28H,1,5-10H2,2H3,(H,25,27)(H,30,31)/t12-,15+,19+,21+,23+,24+/m1/s1 |
| InChIKey | COJYQISVXAULDA-PBXYHTHBSA-N |
| XLogP | 3.23 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|