C34H43NO4 — CID 162677209
N-butyl-5-[4-[(3S,4S)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]-N-methylpentanamide (PubChem CID 162677209) has the molecular formula C34H43NO4 and a molecular weight of 529.72 g/mol. Its IUPAC name is N-butyl-5-[4-[(3S,4S)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]-N-methylpentanamide.
| Compound Name | N-butyl-5-[4-[(3S,4S)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]-N-methylpentanamide |
|---|---|
| PubChem CID | 162677209 |
| Molecular Formula | C34H43NO4 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | N-butyl-5-[4-[(3S,4S)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]-N-methylpentanamide |
| SMILES | CCCCN(C)C(=O)CCCCOc1ccc([C@H]2c3ccc(OC)cc3OC(C)(C)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H43NO4/c1-6-7-22-35(4)31(36)15-11-12-23-38-27-18-16-25(17-19-27)32-29-21-20-28(37-5)24-30(29)39-34(2,3)33(32)26-13-9-8-10-14-26/h8-10,13-14,16-21,24,32-33H,6-7,11-12,15,22-23H2,1-5H3/t32-,33+/m0/s1 |
| InChIKey | ZDRLQVYLLFVASP-JHOUSYSJSA-N |
| XLogP | 7.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|