C15H11N3O2S — CID 162677218
[3-(5-phenylfuran-2-carbonyl)-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 162677218) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is [3-(5-phenylfuran-2-carbonyl)-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | [3-(5-phenylfuran-2-carbonyl)-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 162677218 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [3-(5-phenylfuran-2-carbonyl)-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\SCCN1C(=O)c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H11N3O2S/c16-10-17-15-18(8-9-21-15)14(19)13-7-6-12(20-13)11-4-2-1-3-5-11/h1-7H,8-9H2/b17-15- |
| InChIKey | YIKDZYCLCSLUKI-ICFOKQHNSA-N |
| XLogP | 2.97 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|