C14H17IN4O3 — CID 162677293
(1S,2R,3R,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol (PubChem CID 162677293) has the molecular formula C14H17IN4O3 and a molecular weight of 416.22 g/mol. Its IUPAC name is (1S,2R,3R,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162677293 |
| Molecular Formula | C14H17IN4O3 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | (1S,2R,3R,5R)-5-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)-3-methyl-4-methylidenecyclopentane-1,2-diol |
| SMILES | C=C1[C@@H](n2cc(I)c3c(N)ncnc32)[C@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C14H17IN4O3/c1-6-9(10(21)11(22)14(6,2)4-20)19-3-7(15)8-12(16)17-5-18-13(8)19/h3,5,9-11,20-22H,1,4H2,2H3,(H2,16,17,18)/t9-,10+,11+,14+/m1/s1 |
| InChIKey | ORQVHPGKUUIFNS-ZHPDPMBESA-N |
| XLogP | 0.45 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|