About 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid
2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid (PubChem CID 162677356) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid |
| PubChem CID | 162677356 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid |
| SMILES | CCNc1ccc(Cc2c(C)cc(OCC(=O)O)cc2C)cc1C(C)C |
| InChI | InChI=1S/C22H29NO3/c1-6-23-21-8-7-17(11-19(21)14(2)3)12-20-15(4)9-18(10-16(20)5)26-13-22(24)25/h7-11,14,23H,6,12-13H2,1-5H3,(H,24,25) |
| InChIKey | DXHYPIOBUKIKHV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid?
The IUPAC name of 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid (CID 162677356) is 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid.
What is the SMILES notation for 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid?
The canonical SMILES for 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid is CCNc1ccc(Cc2c(C)cc(OCC(=O)O)cc2C)cc1C(C)C.
What is the InChIKey of 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid?
The InChIKey is DXHYPIOBUKIKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO3/c1-6-23-21-8-7-17(11-19(21)14(2)3)12-20-15(4)9-18(10-16(20)5)26-13-22(24)25/h7-11,14,23H,6,12-13H2,1-5H3,(H,24,25).
What are the key properties of 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid?
2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid has a molecular weight of 355.48 g/mol, XLogP of 4.91, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-(ethylamino)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetic acid is sourced from PubChem (CID 162677356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).