C23H17F3N4O3S — CID 162677419
5-phenyl-1-(4-sulfamoylphenyl)-N-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 162677419) has the molecular formula C23H17F3N4O3S and a molecular weight of 486.48 g/mol. Its IUPAC name is 5-phenyl-1-(4-sulfamoylphenyl)-N-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 5-phenyl-1-(4-sulfamoylphenyl)-N-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162677419 |
| Molecular Formula | C23H17F3N4O3S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 5-phenyl-1-(4-sulfamoylphenyl)-N-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(=O)Nc3ccc(C(F)(F)F)cc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17F3N4O3S/c24-23(25,26)16-6-8-17(9-7-16)28-22(31)20-14-21(15-4-2-1-3-5-15)30(29-20)18-10-12-19(13-11-18)34(27,32)33/h1-14H,(H,28,31)(H2,27,32,33) |
| InChIKey | DGDKMODXYCNXLU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |