C26H20N4O3 — CID 162677487
3-(1,2-benzoxazol-3-yl)-4-[3-(1-propylimidazol-4-yl)-3H-inden-1-yl]pyrrole-2,5-dione (PubChem CID 162677487) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-(1,2-benzoxazol-3-yl)-4-[3-(1-propylimidazol-4-yl)-3H-inden-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1,2-benzoxazol-3-yl)-4-[3-(1-propylimidazol-4-yl)-3H-inden-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 162677487 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-(1,2-benzoxazol-3-yl)-4-[3-(1-propylimidazol-4-yl)-3H-inden-1-yl]pyrrole-2,5-dione |
| SMILES | CCCn1cnc(C2C=C(C3=C(c4noc5ccccc45)C(=O)NC3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C26H20N4O3/c1-2-11-30-13-20(27-14-30)18-12-19(16-8-4-3-7-15(16)18)22-23(26(32)28-25(22)31)24-17-9-5-6-10-21(17)33-29-24/h3-10,12-14,18H,2,11H2,1H3,(H,28,31,32) |
| InChIKey | PORKDACDIRDJMV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|