C18H19NO8Se — CID 162677501
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-3-yl] acetate (PubChem CID 162677501) has the molecular formula C18H19NO8Se and a molecular weight of 456.31 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162677501 |
| Molecular Formula | C18H19NO8Se |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C18H19NO8Se/c1-9(20)25-13-8-24-18(16(27-11(3)22)15(13)26-10(2)21)19-17(23)12-6-4-5-7-14(12)28-19/h4-7,13,15-16,18H,8H2,1-3H3/t13-,15+,16-,18-/m1/s1 |
| InChIKey | KHDBNJXZNPRRPX-NOVWEMISSA-N |
| XLogP | 0.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|