C27H26F2N8O5 — CID 162678291
2-ethyl-N-[3-fluoro-4-[[3-[[(2R)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]-4-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazinane-6-carboxamide (PubChem CID 162678291) has the molecular formula C27H26F2N8O5 and a molecular weight of 580.55 g/mol. Its IUPAC name is 2-ethyl-N-[3-fluoro-4-[[3-[[(2R)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]-4-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazinane-6-carboxamide.
| Compound Name | 2-ethyl-N-[3-fluoro-4-[[3-[[(2R)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]-4-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazinane-6-carboxamide |
|---|---|
| PubChem CID | 162678291 |
| Molecular Formula | C27H26F2N8O5 |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-ethyl-N-[3-fluoro-4-[[3-[[(2R)-1-hydroxypropan-2-yl]amino]-1H-pyrazolo[3,4-b]pyridin-4-yl]oxy]phenyl]-4-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazinane-6-carboxamide |
| SMILES | CCN1NC(C(=O)Nc2ccc(Oc3ccnc4[nH]nc(N[C@H](C)CO)c34)c(F)c2)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C27H26F2N8O5/c1-3-36-27(41)37(17-7-4-15(28)5-8-17)26(40)22(35-36)25(39)32-16-6-9-19(18(29)12-16)42-20-10-11-30-23-21(20)24(34-33-23)31-14(2)13-38/h4-12,14,22,35,38H,3,13H2,1-2H3,(H,32,39)(H2,30,31,33,34)/t14-,22?/m1/s1 |
| InChIKey | JMNMRZITJZXFKA-HNNQXCQYSA-N |
| XLogP | 3.12 |
| TPSA | 164.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|