C22H22F6N2O5S — CID 162678561
(2R)-2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N'-methylbutanediamide (PubChem CID 162678561) has the molecular formula C22H22F6N2O5S and a molecular weight of 540.48 g/mol. Its IUPAC name is (2R)-2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N'-methylbutanediamide.
| Compound Name | (2R)-2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 162678561 |
| Molecular Formula | C22H22F6N2O5S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (2R)-2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N'-methylbutanediamide |
| SMILES | CCS(=O)(=O)c1ccc([C@@H](CC(=O)NC)C(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H22F6N2O5S/c1-3-36(34,35)16-10-4-13(5-11-16)17(12-18(31)29-2)19(32)30-15-8-6-14(7-9-15)20(33,21(23,24)25)22(26,27)28/h4-11,17,33H,3,12H2,1-2H3,(H,29,31)(H,30,32)/t17-/m1/s1 |
| InChIKey | FQOWZQYVIFDJJK-QGZVFWFLSA-N |
| XLogP | 3.65 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |