About 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid
8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 162678887) has the molecular formula C10H15FO4
and a molecular weight of 218.22 g/mol. Its IUPAC name is 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
Molecular Properties
| Compound Name | 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| PubChem CID | 162678887 |
| Molecular Formula | C10H15FO4 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| SMILES | O=C(O)C1(CF)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H15FO4/c11-7-9(8(12)13)1-3-10(4-2-9)14-5-6-15-10/h1-7H2,(H,12,13) |
| InChIKey | PNHIAFOFRVXAGO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The IUPAC name of 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (CID 162678887) is 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
What is the SMILES notation for 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The canonical SMILES for 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid is O=C(O)C1(CF)CCC2(CC1)OCCO2.
What is the InChIKey of 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The InChIKey is PNHIAFOFRVXAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FO4/c11-7-9(8(12)13)1-3-10(4-2-9)14-5-6-15-10/h1-7H2,(H,12,13).
What are the key properties of 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid has a molecular weight of 218.22 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(fluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid is sourced from PubChem (CID 162678887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).