C21H25BN2O3 — CID 162679039
1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 162679039) has the molecular formula C21H25BN2O3 and a molecular weight of 364.25 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 162679039 |
| Molecular Formula | C21H25BN2O3 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(Cn2ccc3c(B4OC(C)(C)C(C)(C)O4)ccnc32)cc1 |
| InChI | InChI=1S/C21H25BN2O3/c1-20(2)21(3,4)27-22(26-20)18-10-12-23-19-17(18)11-13-24(19)14-15-6-8-16(25-5)9-7-15/h6-13H,14H2,1-5H3 |
| InChIKey | SAIHBQTUBVDJOO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|