C27H31N5O4S — CID 162679157
4-(4-methoxyphenyl)-2-(3-methylbutylsulfanyl)-6-[(2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile (PubChem CID 162679157) has the molecular formula C27H31N5O4S and a molecular weight of 521.64 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(3-methylbutylsulfanyl)-6-[(2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-2-(3-methylbutylsulfanyl)-6-[(2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 162679157 |
| Molecular Formula | C27H31N5O4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(3-methylbutylsulfanyl)-6-[(2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(SCCC(C)C)nc(N/N=C\c3cc(OC)c(OC)c(OC)c3)c2C#N)cc1 |
| InChI | InChI=1S/C27H31N5O4S/c1-17(2)11-12-37-27-30-24(19-7-9-20(33-3)10-8-19)21(15-28)26(31-27)32-29-16-18-13-22(34-4)25(36-6)23(14-18)35-5/h7-10,13-14,16-17H,11-12H2,1-6H3,(H,30,31,32)/b29-16- |
| InChIKey | FKNTYSVEUCJLIH-MWLSYYOVSA-N |
| XLogP | 5.63 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|