C41H44N4O3 — CID 162679197
(E,1Z)-4-(2-butoxy-6-methylquinolin-3-yl)-1-[2-(2-butoxy-6-methylquinolin-3-yl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene]but-3-en-2-one (PubChem CID 162679197) has the molecular formula C41H44N4O3 and a molecular weight of 640.83 g/mol. Its IUPAC name is (E,1Z)-4-(2-butoxy-6-methylquinolin-3-yl)-1-[2-(2-butoxy-6-methylquinolin-3-yl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene]but-3-en-2-one.
| Compound Name | (E,1Z)-4-(2-butoxy-6-methylquinolin-3-yl)-1-[2-(2-butoxy-6-methylquinolin-3-yl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene]but-3-en-2-one |
|---|---|
| PubChem CID | 162679197 |
| Molecular Formula | C41H44N4O3 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | (E,1Z)-4-(2-butoxy-6-methylquinolin-3-yl)-1-[2-(2-butoxy-6-methylquinolin-3-yl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-ylidene]but-3-en-2-one |
| SMILES | CCCCOc1nc2ccc(C)cc2cc1/C=C/C(=O)/C=C1/CC(c2cc3cc(C)ccc3nc2OCCCC)Nc2ccccc2N1 |
| InChI | InChI=1S/C41H44N4O3/c1-5-7-19-47-40-29(23-30-21-27(3)13-17-35(30)44-40)15-16-33(46)25-32-26-39(43-38-12-10-9-11-37(38)42-32)34-24-31-22-28(4)14-18-36(31)45-41(34)48-20-8-6-2/h9-18,21-25,39,42-43H,5-8,19-20,26H2,1-4H3/b16-15+,32-25- |
| InChIKey | AWEPYHMZMYLKCH-OYFJQGDWSA-N |
| XLogP | 9.89 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|