C17H32O5 — CID 162679351
(E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid (PubChem CID 162679351) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is (E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid.
| Compound Name | (E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid |
|---|---|
| PubChem CID | 162679351 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid |
| SMILES | CCC(C)C(O)C(C)/C=C/CC[C@@H](O)C[C@@H](O)C(C)C(=O)O |
| InChI | InChI=1S/C17H32O5/c1-5-11(2)16(20)12(3)8-6-7-9-14(18)10-15(19)13(4)17(21)22/h6,8,11-16,18-20H,5,7,9-10H2,1-4H3,(H,21,22)/b8-6+/t11?,12?,13?,14-,15-,16?/m1/s1 |
| InChIKey | CFMKVZLLXFODQC-IPFREJQMSA-N |
| XLogP | 2.20 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|