C5H11FO9P2 — CID 162679614
[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 162679614) has the molecular formula C5H11FO9P2 and a molecular weight of 296.08 g/mol. Its IUPAC name is [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 162679614 |
| Molecular Formula | C5H11FO9P2 |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OC[C@H]1OC[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C5H11FO9P2/c6-3-1-13-4(5(3)7)2-14-17(11,12)15-16(8,9)10/h3-5,7H,1-2H2,(H,11,12)(H2,8,9,10)/t3-,4-,5+/m1/s1 |
| InChIKey | JLUFHMADAUUBBV-WDCZJNDASA-N |
| XLogP | -0.69 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|