[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate

C5H11FO9P2 — CID 162679614

IUPAC[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)OC[C@H]1OC[C@@H](F)[C@@H]1O
InChIInChI=1S/C5H11FO9P2/c6-3-1-13-4(5(3)7)2-14-17(11,12)15-16(8,9)10/h3-5,7H,1-2H2,(H,11,12)(H2,8,9,10)/t3-,4-,5+/m1/s1
InChIKeyJLUFHMADAUUBBV-WDCZJNDASA-N
MW296.08 g/mol
LogP-0.69
Rot. Bonds5

About [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate

[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 162679614) has the molecular formula C5H11FO9P2 and a molecular weight of 296.08 g/mol. Its IUPAC name is [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.

Molecular Properties

Compound Name[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate
PubChem CID162679614
Molecular FormulaC5H11FO9P2
Molecular Weight296.08 g/mol
Exact Mass295.99
IUPAC Name[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)OC[C@H]1OC[C@@H](F)[C@@H]1O
InChIInChI=1S/C5H11FO9P2/c6-3-1-13-4(5(3)7)2-14-17(11,12)15-16(8,9)10/h3-5,7H,1-2H2,(H,11,12)(H2,8,9,10)/t3-,4-,5+/m1/s1
InChIKeyJLUFHMADAUUBBV-WDCZJNDASA-N
XLogP-0.69
TPSA142.75 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.08
LogP ≤ 5-0.69
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate?
The IUPAC name of [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CID 162679614) is [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
What is the SMILES notation for [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate?
The canonical SMILES for [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate is O=P(O)(O)OP(=O)(O)OC[C@H]1OC[C@@H](F)[C@@H]1O.
What is the InChIKey of [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate?
The InChIKey is JLUFHMADAUUBBV-WDCZJNDASA-N. The full InChI is InChI=1S/C5H11FO9P2/c6-3-1-13-4(5(3)7)2-14-17(11,12)15-16(8,9)10/h3-5,7H,1-2H2,(H,11,12)(H2,8,9,10)/t3-,4-,5+/m1/s1.
What are the key properties of [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate?
[(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate has a molecular weight of 296.08 g/mol, XLogP of -0.69, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,4R)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate is sourced from PubChem (CID 162679614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).