About 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide
2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide (PubChem CID 162679999) has the molecular formula C14H12N6O4
and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide |
| PubChem CID | 162679999 |
| Molecular Formula | C14H12N6O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide |
| SMILES | COC1=NC(=O)C(C(=O)Nc2ccc(-c3cn[nH]n3)cc2)C(=O)N1 |
| InChI | InChI=1S/C14H12N6O4/c1-24-14-17-12(22)10(13(23)18-14)11(21)16-8-4-2-7(3-5-8)9-6-15-20-19-9/h2-6,10H,1H3,(H,16,21)(H,15,19,20)(H,17,18,22,23) |
| InChIKey | WPYQKIBPAKQOIU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide?
The IUPAC name of 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide (CID 162679999) is 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide is COC1=NC(=O)C(C(=O)Nc2ccc(-c3cn[nH]n3)cc2)C(=O)N1.
What is the InChIKey of 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide?
The InChIKey is WPYQKIBPAKQOIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O4/c1-24-14-17-12(22)10(13(23)18-14)11(21)16-8-4-2-7(3-5-8)9-6-15-20-19-9/h2-6,10H,1H3,(H,16,21)(H,15,19,20)(H,17,18,22,23).
What are the key properties of 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide?
2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide has a molecular weight of 328.29 g/mol, XLogP of -0.31, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 162679999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).