C22H30ClN5O4 — CID 162680130
N-[(2S)-1-[2-(2-chloroacetyl)-2-[3-(methylamino)-3-oxopropyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-N-methyl-1H-indole-2-carboxamide (PubChem CID 162680130) has the molecular formula C22H30ClN5O4 and a molecular weight of 463.97 g/mol. Its IUPAC name is N-[(2S)-1-[2-(2-chloroacetyl)-2-[3-(methylamino)-3-oxopropyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[2-(2-chloroacetyl)-2-[3-(methylamino)-3-oxopropyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 162680130 |
| Molecular Formula | C22H30ClN5O4 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[(2S)-1-[2-(2-chloroacetyl)-2-[3-(methylamino)-3-oxopropyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-N-methyl-1H-indole-2-carboxamide |
| SMILES | CNC(=O)CCN(NC(=O)[C@H](CC(C)C)N(C)C(=O)c1cc2ccccc2[nH]1)C(=O)CCl |
| InChI | InChI=1S/C22H30ClN5O4/c1-14(2)11-18(21(31)26-28(20(30)13-23)10-9-19(29)24-3)27(4)22(32)17-12-15-7-5-6-8-16(15)25-17/h5-8,12,14,18,25H,9-11,13H2,1-4H3,(H,24,29)(H,26,31)/t18-/m0/s1 |
| InChIKey | MRTADSJWVAUGGG-SFHVURJKSA-N |
| XLogP | 1.89 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|