C18H25ClFN5O5 — CID 162680182
N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-cyclopentyl-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 162680182) has the molecular formula C18H25ClFN5O5 and a molecular weight of 445.88 g/mol. Its IUPAC name is N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-cyclopentyl-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-cyclopentyl-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162680182 |
| Molecular Formula | C18H25ClFN5O5 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-cyclopentyl-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](CC2CCCC2)C(=O)NN(CCC(N)=O)C(=O)C(F)Cl)no1 |
| InChI | InChI=1S/C18H25ClFN5O5/c1-10-8-13(24-30-10)16(27)22-12(9-11-4-2-3-5-11)17(28)23-25(7-6-14(21)26)18(29)15(19)20/h8,11-12,15H,2-7,9H2,1H3,(H2,21,26)(H,22,27)(H,23,28)/t12-,15?/m0/s1 |
| InChIKey | JCBNYZVAMNCKMA-SFVWDYPZSA-N |
| XLogP | 0.93 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|