C20H24O6-2 — CID 162680193
2-[(4Z)-4-[(2E,6E,8E)-2,10-dimethyl-1-oxidododeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetate (PubChem CID 162680193) has the molecular formula C20H24O6-2 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[(4Z)-4-[(2E,6E,8E)-2,10-dimethyl-1-oxidododeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[(2E,6E,8E)-2,10-dimethyl-1-oxidododeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetate |
|---|---|
| PubChem CID | 162680193 |
| Molecular Formula | C20H24O6-2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(4Z)-4-[(2E,6E,8E)-2,10-dimethyl-1-oxidododeca-2,6,8-trienylidene]-3,5-dioxooxolan-2-yl]acetate |
| SMILES | CCC(C)/C=C/C=C/CC/C=C(C)/C([O-])=C1/C(=O)OC(CC(=O)[O-])C1=O |
| InChI | InChI=1S/C20H26O6/c1-4-13(2)10-8-6-5-7-9-11-14(3)18(23)17-19(24)15(12-16(21)22)26-20(17)25/h5-6,8,10-11,13,15,23H,4,7,9,12H2,1-3H3,(H,21,22)/p-2/b6-5+,10-8+,14-11+,18-17- |
| InChIKey | KWCALBMJAYKCIQ-CQWVTYCBSA-L |
| XLogP | 1.12 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|