C19H23O4- — CID 162680195
trihazone D (PubChem CID 162680195) has the molecular formula C19H23O4- and a molecular weight of 315.40 g/mol. Its IUPAC name is (1Z,2E,6E,8E)-2,10-dimethyl-1-(5-methylidene-2,4-dioxooxolan-3-ylidene)dodeca-2,6,8-trien-1-olate.
| Compound Name | trihazone D |
|---|---|
| PubChem CID | 162680195 |
| Molecular Formula | C19H23O4- |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (1Z,2E,6E,8E)-2,10-dimethyl-1-(5-methylidene-2,4-dioxooxolan-3-ylidene)dodeca-2,6,8-trien-1-olate |
| SMILES | CCC(C)/C=C/C=C/CC/C=C(\C)/C(=C/1\C(=O)C(=C)OC1=O)/[O-] |
| InChI | InChI=1S/C19H24O4/c1-5-13(2)11-9-7-6-8-10-12-14(3)17(20)16-18(21)15(4)23-19(16)22/h6-7,9,11-13,20H,4-5,8,10H2,1-3H3/p-1/b7-6+,11-9+,14-12+,17-16- |
| InChIKey | MGHXIJNJUGJJDD-ZVCHMPSQSA-M |
| XLogP | 5.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | 603 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|