About 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid
2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid (PubChem CID 162681176) has the molecular formula C12H17NO7
and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid |
| PubChem CID | 162681176 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid |
| SMILES | COC(=O)CC(=O)N1[C@@H](CC(=O)O)CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H17NO7/c1-19-11(17)6-9(14)13-7(5-10(15)16)3-4-8(13)12(18)20-2/h7-8H,3-6H2,1-2H3,(H,15,16)/t7-,8+/m1/s1 |
| InChIKey | UWNHFIWDWXPIAY-SFYZADRCSA-N |
| XLogP | -0.44 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid?
The IUPAC name of 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid (CID 162681176) is 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid.
What is the SMILES notation for 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid?
The canonical SMILES for 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid is COC(=O)CC(=O)N1[C@@H](CC(=O)O)CC[C@H]1C(=O)OC.
What is the InChIKey of 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid?
The InChIKey is UWNHFIWDWXPIAY-SFYZADRCSA-N. The full InChI is InChI=1S/C12H17NO7/c1-19-11(17)6-9(14)13-7(5-10(15)16)3-4-8(13)12(18)20-2/h7-8H,3-6H2,1-2H3,(H,15,16)/t7-,8+/m1/s1.
What are the key properties of 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid?
2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid has a molecular weight of 287.27 g/mol, XLogP of -0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,5S)-5-methoxycarbonyl-1-(3-methoxy-3-oxopropanoyl)pyrrolidin-2-yl]acetic acid is sourced from PubChem (CID 162681176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).