C20H38BNO2 — CID 162681199
4-methylpent-2-yne;prop-2-en-1-amine;4,4,5,5-tetramethyl-2-[(Z)-pent-2-en-3-yl]-1,3,2-dioxaborolane (PubChem CID 162681199) has the molecular formula C20H38BNO2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-methylpent-2-yne;prop-2-en-1-amine;4,4,5,5-tetramethyl-2-[(Z)-pent-2-en-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4-methylpent-2-yne;prop-2-en-1-amine;4,4,5,5-tetramethyl-2-[(Z)-pent-2-en-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162681199 |
| Molecular Formula | C20H38BNO2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 4-methylpent-2-yne;prop-2-en-1-amine;4,4,5,5-tetramethyl-2-[(Z)-pent-2-en-3-yl]-1,3,2-dioxaborolane |
| SMILES | C/C=C(\CC)B1OC(C)(C)C(C)(C)O1.C=CCN.CC#CC(C)C |
| InChI | InChI=1S/C11H21BO2.C6H10.C3H7N/c1-7-9(8-2)12-13-10(3,4)11(5,6)14-12;1-4-5-6(2)3;1-2-3-4/h7H,8H2,1-6H3;6H,1-3H3;2H,1,3-4H2/b9-7+;; |
| InChIKey | UBPQIFBPQOMEBP-OJYIHNBOSA-N |
| XLogP | 4.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|