C90H54N8 — CID 162681288
2-[2-[4,6-bis[3-(2-cyanophenyl)-5-(3,6-diphenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 162681288) has the molecular formula C90H54N8 and a molecular weight of 1247.48 g/mol. Its IUPAC name is 2-[2-[4,6-bis[3-(2-cyanophenyl)-5-(3,6-diphenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 2-[2-[4,6-bis[3-(2-cyanophenyl)-5-(3,6-diphenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 162681288 |
| Molecular Formula | C90H54N8 |
| Molecular Weight | 1247.48 g/mol |
| Exact Mass | 1246.45 |
| IUPAC Name | 2-[2-[4,6-bis[3-(2-cyanophenyl)-5-(3,6-diphenylcarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1cc(-c2nc(-c3cc(-c4ccccc4C#N)cc(-n4c5ccc(-c6ccccc6)cc5c5cc(-c6ccccc6)ccc54)c3)nc(-c3ccccc3-c3ccccc3C#N)n2)cc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C90H54N8/c91-55-66-29-13-16-32-75(66)69-45-71(49-73(47-69)97-84-41-37-62(58-21-5-1-6-22-58)51-80(84)81-52-63(38-42-85(81)97)59-23-7-2-8-24-59)88-94-89(96-90(95-88)79-36-20-19-35-78(79)77-34-18-15-31-68(77)57-93)72-46-70(76-33-17-14-30-67(76)56-92)48-74(50-72)98-86-43-39-64(60-25-9-3-10-26-60)53-82(86)83-54-65(40-44-87(83)98)61-27-11-4-12-28-61/h1-54H |
| InChIKey | RKOURONKDPQGFM-UHFFFAOYSA-N |
| XLogP | 22.35 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.48 |
| LogP ≤ 5 | 22.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |