C25H20ClF4N3O3 — CID 162682415
7-[5-chloro-2-(1,1,2,2-tetrafluoroethoxy)phenyl]-N-[(2,4-dimethoxyphenyl)methyl]cinnolin-4-amine (PubChem CID 162682415) has the molecular formula C25H20ClF4N3O3 and a molecular weight of 521.90 g/mol. Its IUPAC name is 7-[5-chloro-2-(1,1,2,2-tetrafluoroethoxy)phenyl]-N-[(2,4-dimethoxyphenyl)methyl]cinnolin-4-amine.
| Compound Name | 7-[5-chloro-2-(1,1,2,2-tetrafluoroethoxy)phenyl]-N-[(2,4-dimethoxyphenyl)methyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 162682415 |
| Molecular Formula | C25H20ClF4N3O3 |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 7-[5-chloro-2-(1,1,2,2-tetrafluoroethoxy)phenyl]-N-[(2,4-dimethoxyphenyl)methyl]cinnolin-4-amine |
| SMILES | COc1ccc(CNc2cnnc3cc(-c4cc(Cl)ccc4OC(F)(F)C(F)F)ccc23)c(OC)c1 |
| InChI | InChI=1S/C25H20ClF4N3O3/c1-34-17-6-3-15(23(11-17)35-2)12-31-21-13-32-33-20-9-14(4-7-18(20)21)19-10-16(26)5-8-22(19)36-25(29,30)24(27)28/h3-11,13,24H,12H2,1-2H3,(H,31,33) |
| InChIKey | ZIFQBHLBJLWHLV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|