About 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine
6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine (PubChem CID 162683244) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine.
Molecular Properties
| Compound Name | 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine |
| PubChem CID | 162683244 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine |
| SMILES | CC1=Cn2cncc2CCC1 |
| InChI | InChI=1S/C9H12N2/c1-8-3-2-4-9-5-10-7-11(9)6-8/h5-7H,2-4H2,1H3 |
| InChIKey | OJGOXLIPEULSQY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine?
The IUPAC name of 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine (CID 162683244) is 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine.
What is the SMILES notation for 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine?
The canonical SMILES for 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine is CC1=Cn2cncc2CCC1.
What is the InChIKey of 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine?
The InChIKey is OJGOXLIPEULSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-8-3-2-4-9-5-10-7-11(9)6-8/h5-7H,2-4H2,1H3.
What are the key properties of 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine?
6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine has a molecular weight of 148.21 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-8,9-dihydro-7H-imidazo[1,5-a]azepine is sourced from PubChem (CID 162683244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).