C16H24BNO5 — CID 162684072
methyl (3S)-5-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate (PubChem CID 162684072) has the molecular formula C16H24BNO5 and a molecular weight of 321.18 g/mol. Its IUPAC name is methyl (3S)-5-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate.
| Compound Name | methyl (3S)-5-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
|---|---|
| PubChem CID | 162684072 |
| Molecular Formula | C16H24BNO5 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl (3S)-5-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC2CC(B3OC(C)(C)C(C)(C)O3)=CC(=O)N21 |
| InChI | InChI=1S/C16H24BNO5/c1-15(2)16(3,4)23-17(22-15)10-8-11-6-7-12(14(20)21-5)18(11)13(19)9-10/h9,11-12H,6-8H2,1-5H3/t11?,12-/m0/s1 |
| InChIKey | LTKFXBNRBSTXID-KIYNQFGBSA-N |
| XLogP | 1.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|