C16H17ClN2O3 — CID 162684216
methyl (3S)-7-(2-amino-5-chlorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate (PubChem CID 162684216) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is methyl (3S)-7-(2-amino-5-chlorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate.
| Compound Name | methyl (3S)-7-(2-amino-5-chlorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
|---|---|
| PubChem CID | 162684216 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | methyl (3S)-7-(2-amino-5-chlorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC2CC(c3cc(Cl)ccc3N)=CC(=O)N21 |
| InChI | InChI=1S/C16H17ClN2O3/c1-22-16(21)14-5-3-11-6-9(7-15(20)19(11)14)12-8-10(17)2-4-13(12)18/h2,4,7-8,11,14H,3,5-6,18H2,1H3/t11?,14-/m0/s1 |
| InChIKey | KFNFBAWMXXXFPB-IAXJKZSUSA-N |
| XLogP | 2.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|