C12H17NO4 — CID 162684242
ethyl 2-methyl-5,7-dioxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate (PubChem CID 162684242) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 2-methyl-5,7-dioxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate.
| Compound Name | ethyl 2-methyl-5,7-dioxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
|---|---|
| PubChem CID | 162684242 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 2-methyl-5,7-dioxo-2,3,8,8a-tetrahydro-1H-indolizine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)CC2CC(=O)CC(=O)N21 |
| InChI | InChI=1S/C12H17NO4/c1-3-17-12(16)11-7(2)4-8-5-9(14)6-10(15)13(8)11/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | VKGDXLLJVJQXAP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|