C16H25NO7 — CID 162684449
ethyl (2S,5R)-5-(2-ethoxy-2-oxoethyl)-1-(3-ethoxy-3-oxopropanoyl)pyrrolidine-2-carboxylate (PubChem CID 162684449) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl (2S,5R)-5-(2-ethoxy-2-oxoethyl)-1-(3-ethoxy-3-oxopropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,5R)-5-(2-ethoxy-2-oxoethyl)-1-(3-ethoxy-3-oxopropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162684449 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | ethyl (2S,5R)-5-(2-ethoxy-2-oxoethyl)-1-(3-ethoxy-3-oxopropanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)CC(=O)N1[C@@H](CC(=O)OCC)CC[C@H]1C(=O)OCC |
| InChI | InChI=1S/C16H25NO7/c1-4-22-14(19)9-11-7-8-12(16(21)24-6-3)17(11)13(18)10-15(20)23-5-2/h11-12H,4-10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | FENKTUNIIYVOHU-NEPJUHHUSA-N |
| XLogP | 0.82 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|