C27H34N4O6S — CID 162685241
benzyl N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-3-thiophen-2-ylpropan-2-yl]amino]butan-2-yl]carbamate (PubChem CID 162685241) has the molecular formula C27H34N4O6S and a molecular weight of 542.66 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-3-thiophen-2-ylpropan-2-yl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-3-thiophen-2-ylpropan-2-yl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 162685241 |
| Molecular Formula | C27H34N4O6S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-3-thiophen-2-ylpropan-2-yl]amino]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1cccs1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C27H34N4O6S/c1-17(2)23(31-27(36)37-16-18-7-4-3-5-8-18)26(35)30-22(14-21-9-6-12-38-21)25(34)29-20(15-32)13-19-10-11-28-24(19)33/h3-9,12,15,17,19-20,22-23H,10-11,13-14,16H2,1-2H3,(H,28,33)(H,29,34)(H,30,35)(H,31,36)/t19-,20-,22-,23-/m0/s1 |
| InChIKey | DKUUNMQVKNGRSJ-SQOUVECCSA-N |
| XLogP | 1.94 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|