C22H20F2N2O3 — CID 162685512
2-[[[4-cyano-7-(2,6-difluoro-4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 162685512) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[[[4-cyano-7-(2,6-difluoro-4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-cyano-7-(2,6-difluoro-4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162685512 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[[[4-cyano-7-(2,6-difluoro-4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(-c2c(F)cc(C(C)C)cc2F)c2c(c1C#N)CCO2)C(=O)O |
| InChI | InChI=1S/C22H20F2N2O3/c1-11(2)13-6-17(23)20(18(24)7-13)15-8-19(26-10-12(3)22(27)28)16(9-25)14-4-5-29-21(14)15/h6-8,11,26H,3-5,10H2,1-2H3,(H,27,28) |
| InChIKey | QQSSJQGNBKZTSJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|