About CID 162685524
CID 162685524 (PubChem CID 162685524) has the molecular formula C15H7B2BrClF3O2
and a molecular weight of 413.19 g/mol.
Molecular Properties
| Compound Name | CID 162685524 |
| PubChem CID | 162685524 |
| Molecular Formula | C15H7B2BrClF3O2 |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Cc2c(Cl)c(Br)cc(-c3ccc(OC(F)(F)F)cc3)c2O1 |
| InChI | InChI=1S/C15H7B2BrClF3O2/c16-14(17)6-10-12(19)11(18)5-9(13(10)24-14)7-1-3-8(4-2-7)23-15(20,21)22/h1-5H,6H2 |
| InChIKey | KMNPJBGUTDUFCB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162685524 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162685524?
The IUPAC name of CID 162685524 (CID 162685524) is not available.
What is the SMILES notation for CID 162685524?
The canonical SMILES for CID 162685524 is [B]C1([B])Cc2c(Cl)c(Br)cc(-c3ccc(OC(F)(F)F)cc3)c2O1.
What is the InChIKey of CID 162685524?
The InChIKey is KMNPJBGUTDUFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7B2BrClF3O2/c16-14(17)6-10-12(19)11(18)5-9(13(10)24-14)7-1-3-8(4-2-7)23-15(20,21)22/h1-5H,6H2.
What are the key properties of CID 162685524?
CID 162685524 has a molecular weight of 413.19 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162685524 is sourced from PubChem (CID 162685524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).