C18H15F3N2O — CID 162685580
5-amino-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile (PubChem CID 162685580) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-amino-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile.
| Compound Name | 5-amino-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 162685580 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-amino-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
| SMILES | C[C@@H](c1ccc(-c2cc(N)c(C#N)c3c2OCC3)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O/c1-10(18(19,20)21)11-2-4-12(5-3-11)14-8-16(23)15(9-22)13-6-7-24-17(13)14/h2-5,8,10H,6-7,23H2,1H3/t10-/m0/s1 |
| InChIKey | OSTNJHAJEMPHLT-JTQLQIEISA-N |
| XLogP | 4.41 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|