C22H22F2N2O3 — CID 162685594
2-[[[7-[4-(1,1-difluoroethyl)phenyl]-4-[(methylideneamino)methyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 162685594) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[[[7-[4-(1,1-difluoroethyl)phenyl]-4-[(methylideneamino)methyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[7-[4-(1,1-difluoroethyl)phenyl]-4-[(methylideneamino)methyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162685594 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[[[7-[4-(1,1-difluoroethyl)phenyl]-4-[(methylideneamino)methyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=NCc1c(NCC(=C)C(=O)O)cc(-c2ccc(C(C)(F)F)cc2)c2c1CCO2 |
| InChI | InChI=1S/C22H22F2N2O3/c1-13(21(27)28)11-26-19-10-17(14-4-6-15(7-5-14)22(2,23)24)20-16(8-9-29-20)18(19)12-25-3/h4-7,10,26H,1,3,8-9,11-12H2,2H3,(H,27,28) |
| InChIKey | OJLLCNCTHFDEHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|