About 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile
5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile (PubChem CID 162685602) has the molecular formula C18H18N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile |
| PubChem CID | 162685602 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile |
| SMILES | [2H]C1([2H])COc2c(-c3ccc(C(C)C)cc3)cc(N)c(C#N)c21 |
| InChI | InChI=1S/C18H18N2O/c1-11(2)12-3-5-13(6-4-12)15-9-17(20)16(10-19)14-7-8-21-18(14)15/h3-6,9,11H,7-8,20H2,1-2H3/i7D2 |
| InChIKey | RKXZQYHXEPPSCH-RJSZUWSASA-N |
| XLogP | 3.87 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile?
The IUPAC name of 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile (CID 162685602) is 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile.
What is the SMILES notation for 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile?
The canonical SMILES for 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile is [2H]C1([2H])COc2c(-c3ccc(C(C)C)cc3)cc(N)c(C#N)c21.
What is the InChIKey of 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile?
The InChIKey is RKXZQYHXEPPSCH-RJSZUWSASA-N. The full InChI is InChI=1S/C18H18N2O/c1-11(2)12-3-5-13(6-4-12)15-9-17(20)16(10-19)14-7-8-21-18(14)15/h3-6,9,11H,7-8,20H2,1-2H3/i7D2.
What are the key properties of 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile?
5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile has a molecular weight of 280.37 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3,3-dideuterio-7-(4-propan-2-ylphenyl)-2H-1-benzofuran-4-carbonitrile is sourced from PubChem (CID 162685602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).